C14H26O10 — CID 91847163
(2S,3R,4S,5R)-2-[[(2R,3S,4S,5R,6R)-6-hydroxy-3,4,5-trimethoxyoxan-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 91847163) has the molecular formula C14H26O10 and a molecular weight of 354.35 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[[(2R,3S,4S,5R,6R)-6-hydroxy-3,4,5-trimethoxyoxan-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[[(2R,3S,4S,5R,6R)-6-hydroxy-3,4,5-trimethoxyoxan-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 91847163 |
| Molecular Formula | C14H26O10 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (2S,3R,4S,5R)-2-[[(2R,3S,4S,5R,6R)-6-hydroxy-3,4,5-trimethoxyoxan-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](O)O[C@H](CO[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1OC |
| InChI | InChI=1S/C14H26O10/c1-19-10-7(24-13(18)12(21-3)11(10)20-2)5-23-14-9(17)8(16)6(15)4-22-14/h6-18H,4-5H2,1-3H3/t6-,7-,8+,9-,10+,11+,12-,13-,14+/m1/s1 |
| InChIKey | KKLOHUWXXPCYCJ-KFNWZVQOSA-N |
| XLogP | -2.80 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |