C10H20O5 — CID 76704011
2,3-dimethoxy-6-(methoxymethyl)-5-methyloxan-4-ol (PubChem CID 76704011) has the molecular formula C10H20O5 and a molecular weight of 220.26 g/mol. Its IUPAC name is 2,3-dimethoxy-6-(methoxymethyl)-5-methyloxan-4-ol.
| Compound Name | 2,3-dimethoxy-6-(methoxymethyl)-5-methyloxan-4-ol |
|---|---|
| PubChem CID | 76704011 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2,3-dimethoxy-6-(methoxymethyl)-5-methyloxan-4-ol |
| SMILES | COCC1OC(OC)C(OC)C(O)C1C |
| InChI | InChI=1S/C10H20O5/c1-6-7(5-12-2)15-10(14-4)9(13-3)8(6)11/h6-11H,5H2,1-4H3 |
| InChIKey | LYJZEKZUKMKGBH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |