C24H48O15 — CID 162222185
(2S,3R,4S,5S,6S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol (PubChem CID 162222185) has the molecular formula C24H48O15 and a molecular weight of 576.63 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol.
| Compound Name | (2S,3R,4S,5S,6S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 162222185 |
| Molecular Formula | C24H48O15 |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | (2S,3R,4S,5S,6S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](C)[C@H](O)[C@H]1O.CO[C@H]1O[C@H](CO)[C@@H](C)[C@H](O)[C@H]1O.CO[C@H]1O[C@H](CO)[C@@H](C)[C@H](O)[C@H]1O |
| InChI | InChI=1S/3C8H16O5/c3*1-4-5(3-9)13-8(12-2)7(11)6(4)10/h3*4-11H,3H2,1-2H3/t3*4-,5-,6+,7-,8+/m111/s1 |
| InChIKey | ZUGRWZCBGDFNQB-XKCKQQPGSA-N |
| XLogP | -3.88 |
| TPSA | 237.45 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |