C16H32O11 — CID 126968510
2-[[(2R,3S,4S,5R,6S)-3,4,5,6-tetrakis(2-hydroxyethoxy)oxan-2-yl]methoxy]ethanol (PubChem CID 126968510) has the molecular formula C16H32O11 and a molecular weight of 400.42 g/mol. Its IUPAC name is 2-[[(2R,3S,4S,5R,6S)-3,4,5,6-tetrakis(2-hydroxyethoxy)oxan-2-yl]methoxy]ethanol.
| Compound Name | 2-[[(2R,3S,4S,5R,6S)-3,4,5,6-tetrakis(2-hydroxyethoxy)oxan-2-yl]methoxy]ethanol |
|---|---|
| PubChem CID | 126968510 |
| Molecular Formula | C16H32O11 |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[[(2R,3S,4S,5R,6S)-3,4,5,6-tetrakis(2-hydroxyethoxy)oxan-2-yl]methoxy]ethanol |
| SMILES | OCCOC[C@H]1O[C@H](OCCO)[C@H](OCCO)[C@@H](OCCO)[C@H]1OCCO |
| InChI | InChI=1S/C16H32O11/c17-1-6-22-11-12-13(23-7-2-18)14(24-8-3-19)15(25-9-4-20)16(27-12)26-10-5-21/h12-21H,1-11H2/t12-,13+,14+,15-,16+/m1/s1 |
| InChIKey | BWVCVZYWCNNQME-CWVYHPPDSA-N |
| XLogP | -3.14 |
| TPSA | 156.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|