C30H59NO11S — CID 58658289
N-sulfanyl-4-[3,4,5-tris(4-methoxybutoxy)-6-(4-methoxybutoxymethyl)oxan-2-yl]oxybutanamide (PubChem CID 58658289) has the molecular formula C30H59NO11S and a molecular weight of 641.87 g/mol. Its IUPAC name is N-sulfanyl-4-[3,4,5-tris(4-methoxybutoxy)-6-(4-methoxybutoxymethyl)oxan-2-yl]oxybutanamide.
| Compound Name | N-sulfanyl-4-[3,4,5-tris(4-methoxybutoxy)-6-(4-methoxybutoxymethyl)oxan-2-yl]oxybutanamide |
|---|---|
| PubChem CID | 58658289 |
| Molecular Formula | C30H59NO11S |
| Molecular Weight | 641.87 g/mol |
| Exact Mass | 641.38 |
| IUPAC Name | N-sulfanyl-4-[3,4,5-tris(4-methoxybutoxy)-6-(4-methoxybutoxymethyl)oxan-2-yl]oxybutanamide |
| SMILES | COCCCCOCC1OC(OCCCC(=O)NS)C(OCCCCOC)C(OCCCCOC)C1OCCCCOC |
| InChI | InChI=1S/C30H59NO11S/c1-33-15-5-9-19-37-24-25-27(38-20-10-6-16-34-2)28(39-21-11-7-17-35-3)29(40-22-12-8-18-36-4)30(42-25)41-23-13-14-26(32)31-43/h25,27-30,43H,5-24H2,1-4H3,(H,31,32) |
| InChIKey | MXZNCEIGJHUZJC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.87 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|