C29H60O10Si3 — CID 66847483
methyl 6-[[(2R,3R,4S,5S,6S)-6-(6-methoxy-6-oxohexoxy)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methoxy]hexanoate (PubChem CID 66847483) has the molecular formula C29H60O10Si3 and a molecular weight of 653.05 g/mol. Its IUPAC name is methyl 6-[[(2R,3R,4S,5S,6S)-6-(6-methoxy-6-oxohexoxy)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methoxy]hexanoate.
| Compound Name | methyl 6-[[(2R,3R,4S,5S,6S)-6-(6-methoxy-6-oxohexoxy)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methoxy]hexanoate |
|---|---|
| PubChem CID | 66847483 |
| Molecular Formula | C29H60O10Si3 |
| Molecular Weight | 653.05 g/mol |
| Exact Mass | 652.35 |
| IUPAC Name | methyl 6-[[(2R,3R,4S,5S,6S)-6-(6-methoxy-6-oxohexoxy)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methoxy]hexanoate |
| SMILES | COC(=O)CCCCCOC[C@H]1O[C@H](OCCCCCC(=O)OC)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C29H60O10Si3/c1-32-24(30)18-14-12-16-20-34-22-23-26(37-40(3,4)5)27(38-41(6,7)8)28(39-42(9,10)11)29(36-23)35-21-17-13-15-19-25(31)33-2/h23,26-29H,12-22H2,1-11H3/t23-,26-,27+,28+,29+/m1/s1 |
| InChIKey | ORILFKVMCCHVCB-BSNVCIOISA-N |
| XLogP | 5.87 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.05 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|