C26H45NO10S — CID 162200363
[3-acetyloxy-4,5-dimethyl-6-[[3,4,5-trimethyl-6-[5-oxo-5-(sulfanylamino)pentoxy]oxan-2-yl]methylperoxy]oxan-2-yl]methyl acetate (PubChem CID 162200363) has the molecular formula C26H45NO10S and a molecular weight of 563.71 g/mol. Its IUPAC name is [3-acetyloxy-4,5-dimethyl-6-[[3,4,5-trimethyl-6-[5-oxo-5-(sulfanylamino)pentoxy]oxan-2-yl]methylperoxy]oxan-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-4,5-dimethyl-6-[[3,4,5-trimethyl-6-[5-oxo-5-(sulfanylamino)pentoxy]oxan-2-yl]methylperoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162200363 |
| Molecular Formula | C26H45NO10S |
| Molecular Weight | 563.71 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | [3-acetyloxy-4,5-dimethyl-6-[[3,4,5-trimethyl-6-[5-oxo-5-(sulfanylamino)pentoxy]oxan-2-yl]methylperoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OOCC2OC(OCCCCC(=O)NS)C(C)C(C)C2C)C(C)C(C)C1OC(C)=O |
| InChI | InChI=1S/C26H45NO10S/c1-14-15(2)21(35-25(17(14)4)31-11-9-8-10-23(30)27-38)13-33-37-26-18(5)16(3)24(34-20(7)29)22(36-26)12-32-19(6)28/h14-18,21-22,24-26,38H,8-13H2,1-7H3,(H,27,30) |
| InChIKey | ZRMPULDHWBJFHW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.71 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|