C16H26O8 — CID 134167078
4-[4-acetyloxy-6-(acetyloxymethyl)-3,5-dimethyloxan-2-yl]oxybutanoic acid (PubChem CID 134167078) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is 4-[4-acetyloxy-6-(acetyloxymethyl)-3,5-dimethyloxan-2-yl]oxybutanoic acid.
| Compound Name | 4-[4-acetyloxy-6-(acetyloxymethyl)-3,5-dimethyloxan-2-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 134167078 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4-[4-acetyloxy-6-(acetyloxymethyl)-3,5-dimethyloxan-2-yl]oxybutanoic acid |
| SMILES | CC(=O)OCC1OC(OCCCC(=O)O)C(C)C(OC(C)=O)C1C |
| InChI | InChI=1S/C16H26O8/c1-9-13(8-22-11(3)17)24-16(21-7-5-6-14(19)20)10(2)15(9)23-12(4)18/h9-10,13,15-16H,5-8H2,1-4H3,(H,19,20) |
| InChIKey | NDPUMRDJUKLHPU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|