C17H27NO10 — CID 167543539
2-[2-[(2R,3R,4S,5R,6S)-3-acetamido-4-acetyloxy-6-(acetyloxymethyl)-5-methyloxan-2-yl]oxyethoxy]acetic acid (PubChem CID 167543539) has the molecular formula C17H27NO10 and a molecular weight of 405.40 g/mol. Its IUPAC name is 2-[2-[(2R,3R,4S,5R,6S)-3-acetamido-4-acetyloxy-6-(acetyloxymethyl)-5-methyloxan-2-yl]oxyethoxy]acetic acid.
| Compound Name | 2-[2-[(2R,3R,4S,5R,6S)-3-acetamido-4-acetyloxy-6-(acetyloxymethyl)-5-methyloxan-2-yl]oxyethoxy]acetic acid |
|---|---|
| PubChem CID | 167543539 |
| Molecular Formula | C17H27NO10 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-[2-[(2R,3R,4S,5R,6S)-3-acetamido-4-acetyloxy-6-(acetyloxymethyl)-5-methyloxan-2-yl]oxyethoxy]acetic acid |
| SMILES | CC(=O)N[C@H]1[C@H](OCCOCC(=O)O)O[C@H](COC(C)=O)[C@H](C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H27NO10/c1-9-13(7-26-11(3)20)28-17(25-6-5-24-8-14(22)23)15(18-10(2)19)16(9)27-12(4)21/h9,13,15-17H,5-8H2,1-4H3,(H,18,19)(H,22,23)/t9-,13+,15+,16-,17+/m0/s1 |
| InChIKey | VOWRBTSDBZWDNN-HNLXRAMASA-N |
| XLogP | -0.54 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|