C23H32O8 — CID 174343827
benzyl 4-[5-acetyloxy-6-(acetyloxymethyl)-3,4-dimethyloxan-2-yl]oxybutanoate (PubChem CID 174343827) has the molecular formula C23H32O8 and a molecular weight of 436.50 g/mol. Its IUPAC name is benzyl 4-[5-acetyloxy-6-(acetyloxymethyl)-3,4-dimethyloxan-2-yl]oxybutanoate.
| Compound Name | benzyl 4-[5-acetyloxy-6-(acetyloxymethyl)-3,4-dimethyloxan-2-yl]oxybutanoate |
|---|---|
| PubChem CID | 174343827 |
| Molecular Formula | C23H32O8 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | benzyl 4-[5-acetyloxy-6-(acetyloxymethyl)-3,4-dimethyloxan-2-yl]oxybutanoate |
| SMILES | CC(=O)OCC1OC(OCCCC(=O)OCc2ccccc2)C(C)C(C)C1OC(C)=O |
| InChI | InChI=1S/C23H32O8/c1-15-16(2)23(31-20(14-28-17(3)24)22(15)30-18(4)25)27-12-8-11-21(26)29-13-19-9-6-5-7-10-19/h5-7,9-10,15-16,20,22-23H,8,11-14H2,1-4H3 |
| InChIKey | ATQWHICIRUYRTO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|