C26H37NO10 — CID 91578157
benzyl 2-amino-6-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxyhexanoate (PubChem CID 91578157) has the molecular formula C26H37NO10 and a molecular weight of 523.58 g/mol. Its IUPAC name is benzyl 2-amino-6-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxyhexanoate.
| Compound Name | benzyl 2-amino-6-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 91578157 |
| Molecular Formula | C26H37NO10 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | benzyl 2-amino-6-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxyhexanoate |
| SMILES | CC(=O)OCC1OC(OCCCCC(N)C(=O)OCc2ccccc2)C(C)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C26H37NO10/c1-16-23(35-18(3)29)24(36-19(4)30)22(15-33-17(2)28)37-26(16)32-13-9-8-12-21(27)25(31)34-14-20-10-6-5-7-11-20/h5-7,10-11,16,21-24,26H,8-9,12-15,27H2,1-4H3 |
| InChIKey | LVXBCYVVGNIMGC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|