C25H37NO8 — CID 121459049
[(3R,4S,5S)-5-acetyloxy-3,4-dimethyl-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-2-yl]methyl acetate (PubChem CID 121459049) has the molecular formula C25H37NO8 and a molecular weight of 479.57 g/mol. Its IUPAC name is [(3R,4S,5S)-5-acetyloxy-3,4-dimethyl-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,5S)-5-acetyloxy-3,4-dimethyl-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 121459049 |
| Molecular Formula | C25H37NO8 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | [(3R,4S,5S)-5-acetyloxy-3,4-dimethyl-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OCCCCCNC(=O)OCc2ccccc2)[C@@H](OC(C)=O)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C25H37NO8/c1-17-18(2)23(33-20(4)28)24(34-22(17)16-31-19(3)27)30-14-10-6-9-13-26-25(29)32-15-21-11-7-5-8-12-21/h5,7-8,11-12,17-18,22-24H,6,9-10,13-16H2,1-4H3,(H,26,29)/t17-,18+,22?,23+,24?/m1/s1 |
| InChIKey | WDWUCLAITTXBJH-XZJKGKPQSA-N |
| XLogP | 3.59 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|