C30H54O13 — CID 162021489
methyl 5-[6-(acetyloxymethyl)-3,4,5-trimethyloxan-2-yl]oxypentanoate;methyl 5-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxypentanoate (PubChem CID 162021489) has the molecular formula C30H54O13 and a molecular weight of 622.75 g/mol. Its IUPAC name is methyl 5-[6-(acetyloxymethyl)-3,4,5-trimethyloxan-2-yl]oxypentanoate;methyl 5-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxypentanoate.
| Compound Name | methyl 5-[6-(acetyloxymethyl)-3,4,5-trimethyloxan-2-yl]oxypentanoate;methyl 5-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxypentanoate |
|---|---|
| PubChem CID | 162021489 |
| Molecular Formula | C30H54O13 |
| Molecular Weight | 622.75 g/mol |
| Exact Mass | 622.36 |
| IUPAC Name | methyl 5-[6-(acetyloxymethyl)-3,4,5-trimethyloxan-2-yl]oxypentanoate;methyl 5-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxypentanoate |
| SMILES | COC(=O)CCCCOC1OC(CO)C(O)C(O)C1C.COC(=O)CCCCOC1OC(COC(C)=O)C(C)C(C)C1C |
| InChI | InChI=1S/C17H30O6.C13H24O7/c1-11-12(2)15(10-22-14(4)18)23-17(13(11)3)21-9-7-6-8-16(19)20-5;1-8-11(16)12(17)9(7-14)20-13(8)19-6-4-3-5-10(15)18-2/h11-13,15,17H,6-10H2,1-5H3;8-9,11-14,16-17H,3-7H2,1-2H3 |
| InChIKey | YUUPYOJRJYGSJT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 176.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.75 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|