C15H27NO9 — CID 167641492
5-[4,5-dihydroxy-6-(2-hydroxyethylcarbamoyloxymethyl)-3-methyloxan-2-yl]oxypentanoic acid (PubChem CID 167641492) has the molecular formula C15H27NO9 and a molecular weight of 365.38 g/mol. Its IUPAC name is 5-[4,5-dihydroxy-6-(2-hydroxyethylcarbamoyloxymethyl)-3-methyloxan-2-yl]oxypentanoic acid.
| Compound Name | 5-[4,5-dihydroxy-6-(2-hydroxyethylcarbamoyloxymethyl)-3-methyloxan-2-yl]oxypentanoic acid |
|---|---|
| PubChem CID | 167641492 |
| Molecular Formula | C15H27NO9 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 5-[4,5-dihydroxy-6-(2-hydroxyethylcarbamoyloxymethyl)-3-methyloxan-2-yl]oxypentanoic acid |
| SMILES | CC1C(OCCCCC(=O)O)OC(COC(=O)NCCO)C(O)C1O |
| InChI | InChI=1S/C15H27NO9/c1-9-12(20)13(21)10(8-24-15(22)16-5-6-17)25-14(9)23-7-3-2-4-11(18)19/h9-10,12-14,17,20-21H,2-8H2,1H3,(H,16,22)(H,18,19) |
| InChIKey | GUKBWCCIDCBVFW-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 154.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|