C21H40N2O10S — CID 159920219
N-[3-[(2R,4R,5S)-3-amino-6-[[(2R,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxymethyl]-4,5-dihydroxyoxan-2-yl]oxypropyl]-4-methylsulfanylbutanamide (PubChem CID 159920219) has the molecular formula C21H40N2O10S and a molecular weight of 512.62 g/mol. Its IUPAC name is N-[3-[(2R,4R,5S)-3-amino-6-[[(2R,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxymethyl]-4,5-dihydroxyoxan-2-yl]oxypropyl]-4-methylsulfanylbutanamide.
| Compound Name | N-[3-[(2R,4R,5S)-3-amino-6-[[(2R,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxymethyl]-4,5-dihydroxyoxan-2-yl]oxypropyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 159920219 |
| Molecular Formula | C21H40N2O10S |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | N-[3-[(2R,4R,5S)-3-amino-6-[[(2R,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxymethyl]-4,5-dihydroxyoxan-2-yl]oxypropyl]-4-methylsulfanylbutanamide |
| SMILES | CSCCCC(=O)NCCCO[C@@H]1OC(CO[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2C)[C@@H](O)[C@H](O)C1N |
| InChI | InChI=1S/C21H40N2O10S/c1-11-16(26)17(27)12(9-24)32-20(11)31-10-13-18(28)19(29)15(22)21(33-13)30-7-4-6-23-14(25)5-3-8-34-2/h11-13,15-21,24,26-29H,3-10,22H2,1-2H3,(H,23,25)/t11?,12?,13?,15?,16-,17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | WJJVYDFRZKPJML-IQUFRJCHSA-N |
| XLogP | -2.48 |
| TPSA | 193.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|