C23H29F5O6 — CID 174061685
(2,3,4,5,6-pentafluorophenyl) 6-[(2R,4S,5R)-6-(acetyloxymethyl)-3,4,5-trimethyloxan-2-yl]oxyhexanoate (PubChem CID 174061685) has the molecular formula C23H29F5O6 and a molecular weight of 496.47 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 6-[(2R,4S,5R)-6-(acetyloxymethyl)-3,4,5-trimethyloxan-2-yl]oxyhexanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 6-[(2R,4S,5R)-6-(acetyloxymethyl)-3,4,5-trimethyloxan-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 174061685 |
| Molecular Formula | C23H29F5O6 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 6-[(2R,4S,5R)-6-(acetyloxymethyl)-3,4,5-trimethyloxan-2-yl]oxyhexanoate |
| SMILES | CC(=O)OCC1O[C@@H](OCCCCCC(=O)Oc2c(F)c(F)c(F)c(F)c2F)C(C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C23H29F5O6/c1-11-12(2)15(10-32-14(4)29)33-23(13(11)3)31-9-7-5-6-8-16(30)34-22-20(27)18(25)17(24)19(26)21(22)28/h11-13,15,23H,5-10H2,1-4H3/t11-,12+,13?,15?,23+/m0/s1 |
| InChIKey | GOXASXLZXUPXSD-DDOBKSQISA-N |
| XLogP | 5.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|