C16H30O3 — CID 155642872
6-(6-ethyl-3,4,5-trimethyloxan-2-yl)oxyhexan-2-one (PubChem CID 155642872) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 6-(6-ethyl-3,4,5-trimethyloxan-2-yl)oxyhexan-2-one.
| Compound Name | 6-(6-ethyl-3,4,5-trimethyloxan-2-yl)oxyhexan-2-one |
|---|---|
| PubChem CID | 155642872 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 6-(6-ethyl-3,4,5-trimethyloxan-2-yl)oxyhexan-2-one |
| SMILES | CCC1OC(OCCCCC(C)=O)C(C)C(C)C1C |
| InChI | InChI=1S/C16H30O3/c1-6-15-13(4)12(3)14(5)16(19-15)18-10-8-7-9-11(2)17/h12-16H,6-10H2,1-5H3 |
| InChIKey | SLAQZMJFNVPQBZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|