C16H32O3 — CID 163584230
(2R,4S,5S)-6-ethyl-2-heptoxy-4,5-dimethyloxan-3-ol (PubChem CID 163584230) has the molecular formula C16H32O3 and a molecular weight of 272.43 g/mol. Its IUPAC name is (2R,4S,5S)-6-ethyl-2-heptoxy-4,5-dimethyloxan-3-ol.
| Compound Name | (2R,4S,5S)-6-ethyl-2-heptoxy-4,5-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 163584230 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | (2R,4S,5S)-6-ethyl-2-heptoxy-4,5-dimethyloxan-3-ol |
| SMILES | CCCCCCCO[C@@H]1OC(CC)[C@@H](C)[C@H](C)C1O |
| InChI | InChI=1S/C16H32O3/c1-5-7-8-9-10-11-18-16-15(17)13(4)12(3)14(6-2)19-16/h12-17H,5-11H2,1-4H3/t12-,13-,14?,15?,16+/m0/s1 |
| InChIKey | GKDAAMQLLGSTJF-RKVQBDSKSA-N |
| XLogP | 3.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|