C15H30O2 — CID 122599309
(3R,5R)-2-ethyl-3,4,5-trimethyl-6-(3-methylbutoxy)oxane (PubChem CID 122599309) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is (3R,5R)-2-ethyl-3,4,5-trimethyl-6-(3-methylbutoxy)oxane.
| Compound Name | (3R,5R)-2-ethyl-3,4,5-trimethyl-6-(3-methylbutoxy)oxane |
|---|---|
| PubChem CID | 122599309 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | (3R,5R)-2-ethyl-3,4,5-trimethyl-6-(3-methylbutoxy)oxane |
| SMILES | CCC1OC(OCCC(C)C)[C@H](C)C(C)[C@H]1C |
| InChI | InChI=1S/C15H30O2/c1-7-14-12(5)11(4)13(6)15(17-14)16-9-8-10(2)3/h10-15H,7-9H2,1-6H3/t11?,12-,13-,14?,15?/m1/s1 |
| InChIKey | JMMFDBZKTRMGNM-YATPQJKZSA-N |
| XLogP | 4.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |