C31H62O21S10 — CID 10748695
2-[3-[[(2R,3R,4S,5R,6S)-3,4,5,6-tetrakis[3-(2-sulfoethylsulfanyl)propoxy]oxan-2-yl]methoxy]propylsulfanyl]ethanesulfonic acid (PubChem CID 10748695) has the molecular formula C31H62O21S10 and a molecular weight of 1091.49 g/mol. Its IUPAC name is 2-[3-[[(2R,3R,4S,5R,6S)-3,4,5,6-tetrakis[3-(2-sulfoethylsulfanyl)propoxy]oxan-2-yl]methoxy]propylsulfanyl]ethanesulfonic acid.
| Compound Name | 2-[3-[[(2R,3R,4S,5R,6S)-3,4,5,6-tetrakis[3-(2-sulfoethylsulfanyl)propoxy]oxan-2-yl]methoxy]propylsulfanyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 10748695 |
| Molecular Formula | C31H62O21S10 |
| Molecular Weight | 1091.49 g/mol |
| Exact Mass | 1090.10 |
| IUPAC Name | 2-[3-[[(2R,3R,4S,5R,6S)-3,4,5,6-tetrakis[3-(2-sulfoethylsulfanyl)propoxy]oxan-2-yl]methoxy]propylsulfanyl]ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCSCCCOC[C@H]1O[C@H](OCCCSCCS(=O)(=O)O)[C@H](OCCCSCCS(=O)(=O)O)[C@@H](OCCCSCCS(=O)(=O)O)[C@@H]1OCCCSCCS(=O)(=O)O |
| InChI | InChI=1S/C31H62O21S10/c32-58(33,34)21-16-53-11-1-6-47-26-27-28(48-7-2-12-54-17-22-59(35,36)37)29(49-8-3-13-55-18-23-60(38,39)40)30(50-9-4-14-56-19-24-61(41,42)43)31(52-27)51-10-5-15-57-20-25-62(44,45)46/h27-31H,1-26H2,(H,32,33,34)(H,35,36,37)(H,38,39,40)(H,41,42,43)(H,44,45,46)/t27-,28-,29+,30-,31+/m1/s1 |
| InChIKey | JITNTPZQDZKBNJ-SAEUYMBFSA-N |
| XLogP | 1.96 |
| TPSA | 327.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1091.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|