C10H20O9S — CID 155641941
4-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]butane-1-sulfonic acid (PubChem CID 155641941) has the molecular formula C10H20O9S and a molecular weight of 316.33 g/mol. Its IUPAC name is 4-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]butane-1-sulfonic acid.
| Compound Name | 4-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 155641941 |
| Molecular Formula | C10H20O9S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]butane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCOCC1OC(O)C(O)C(O)C1O |
| InChI | InChI=1S/C10H20O9S/c11-7-6(19-10(14)9(13)8(7)12)5-18-3-1-2-4-20(15,16)17/h6-14H,1-5H2,(H,15,16,17) |
| InChIKey | JXLNUICNMCNXDS-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|