C6H13NO8S — CID 53322463
[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl sulfamate (PubChem CID 53322463) has the molecular formula C6H13NO8S and a molecular weight of 259.24 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 53322463 |
| Molecular Formula | C6H13NO8S |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO8S/c7-16(12,13)14-1-2-3(8)4(9)5(10)6(11)15-2/h2-6,8-11H,1H2,(H2,7,12,13)/t2-,3-,4+,5-,6?/m1/s1 |
| InChIKey | PHTDYYFDBIUKPL-GASJEMHNSA-N |
| XLogP | -3.99 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |