C6H12NO8S- — CID 90659837
[(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl sulfate (PubChem CID 90659837) has the molecular formula C6H12NO8S- and a molecular weight of 258.23 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl sulfate.
| Compound Name | [(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl sulfate |
|---|---|
| PubChem CID | 90659837 |
| Molecular Formula | C6H12NO8S- |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | [(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl sulfate |
| SMILES | N[C@H]1C(O)O[C@H](COS(=O)(=O)[O-])[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO8S/c7-3-5(9)4(8)2(15-6(3)10)1-14-16(11,12)13/h2-6,8-10H,1,7H2,(H,11,12,13)/p-1/t2-,3-,4-,5-,6?/m1/s1 |
| InChIKey | MTDHILKWIRSIHB-IVMDWMLBSA-M |
| XLogP | -3.77 |
| TPSA | 162.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|