C6H14KNO9S — CID 25020353
potassium;(2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrogen sulfate (PubChem CID 25020353) has the molecular formula C6H14KNO9S and a molecular weight of 315.34 g/mol. Its IUPAC name is potassium;(2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrogen sulfate.
| Compound Name | potassium;(2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrogen sulfate |
|---|---|
| PubChem CID | 25020353 |
| Molecular Formula | C6H14KNO9S |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | potassium;(2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrogen sulfate |
| SMILES | N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O.O=S(=O)([O-])O.[K+] |
| InChI | InChI=1S/C6H13NO5.K.H2O4S/c7-3-5(10)4(9)2(1-8)12-6(3)11;;1-5(2,3)4/h2-6,8-11H,1,7H2;;(H2,1,2,3,4)/q;+1;/p-1/t2-,3-,4-,5-,6-;;/m1../s1 |
| InChIKey | HREMULIJDCVGBM-YOAZZGITSA-M |
| XLogP | -7.25 |
| TPSA | 193.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | -7.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|