C5H11NO4 — CID 55288704
(2R,3S,4S,5R)-3-amino-5-(hydroxymethyl)oxolane-2,4-diol (PubChem CID 55288704) has the molecular formula C5H11NO4 and a molecular weight of 149.15 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-amino-5-(hydroxymethyl)oxolane-2,4-diol.
| Compound Name | (2R,3S,4S,5R)-3-amino-5-(hydroxymethyl)oxolane-2,4-diol |
|---|---|
| PubChem CID | 55288704 |
| Molecular Formula | C5H11NO4 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | (2R,3S,4S,5R)-3-amino-5-(hydroxymethyl)oxolane-2,4-diol |
| SMILES | N[C@H]1[C@H](O)[C@@H](CO)O[C@H]1O |
| InChI | InChI=1S/C5H11NO4/c6-3-4(8)2(1-7)10-5(3)9/h2-5,7-9H,1,6H2/t2-,3+,4-,5-/m1/s1 |
| InChIKey | WVFLQJAIFBHEMM-KKQCNMDGSA-N |
| XLogP | -2.62 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |