C44H60N4O14S4 — CID 87663615
1-[3-[2-[[(2R,3S,4S,5R,6S)-3,4,5-tris[2-[3-(2,5-dioxopyrrol-1-yl)propylsulfanyl]ethoxy]-6-ethoxyoxan-2-yl]methoxy]ethylsulfanyl]propyl]pyrrole-2,5-dione (PubChem CID 87663615) has the molecular formula C44H60N4O14S4 and a molecular weight of 997.25 g/mol. Its IUPAC name is 1-[3-[2-[[(2R,3S,4S,5R,6S)-3,4,5-tris[2-[3-(2,5-dioxopyrrol-1-yl)propylsulfanyl]ethoxy]-6-ethoxyoxan-2-yl]methoxy]ethylsulfanyl]propyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-[2-[[(2R,3S,4S,5R,6S)-3,4,5-tris[2-[3-(2,5-dioxopyrrol-1-yl)propylsulfanyl]ethoxy]-6-ethoxyoxan-2-yl]methoxy]ethylsulfanyl]propyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 87663615 |
| Molecular Formula | C44H60N4O14S4 |
| Molecular Weight | 997.25 g/mol |
| Exact Mass | 996.30 |
| IUPAC Name | 1-[3-[2-[[(2R,3S,4S,5R,6S)-3,4,5-tris[2-[3-(2,5-dioxopyrrol-1-yl)propylsulfanyl]ethoxy]-6-ethoxyoxan-2-yl]methoxy]ethylsulfanyl]propyl]pyrrole-2,5-dione |
| SMILES | CCO[C@H]1O[C@H](COCCSCCCN2C(=O)C=CC2=O)[C@H](OCCSCCCN2C(=O)C=CC2=O)[C@H](OCCSCCCN2C(=O)C=CC2=O)[C@H]1OCCSCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C44H60N4O14S4/c1-2-58-44-43(61-22-30-66-26-6-18-48-39(55)13-14-40(48)56)42(60-21-29-65-25-5-17-47-37(53)11-12-38(47)54)41(59-20-28-64-24-4-16-46-35(51)9-10-36(46)52)32(62-44)31-57-19-27-63-23-3-15-45-33(49)7-8-34(45)50/h7-14,32,41-44H,2-6,15-31H2,1H3/t32-,41+,42+,43-,44+/m1/s1 |
| InChIKey | WJTRTJOTEYNKDU-FBAUDAQCSA-N |
| XLogP | 2.11 |
| TPSA | 204.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|