C27H46O14S4 — CID 10676376
2-[3-[[(2R,3R,4S,5R,6S)-3,4,5-tris[3-(carboxymethylsulfanyl)propoxy]-6-methoxyoxan-2-yl]methoxy]propylsulfanyl]acetic acid (PubChem CID 10676376) has the molecular formula C27H46O14S4 and a molecular weight of 722.92 g/mol. Its IUPAC name is 2-[3-[[(2R,3R,4S,5R,6S)-3,4,5-tris[3-(carboxymethylsulfanyl)propoxy]-6-methoxyoxan-2-yl]methoxy]propylsulfanyl]acetic acid.
| Compound Name | 2-[3-[[(2R,3R,4S,5R,6S)-3,4,5-tris[3-(carboxymethylsulfanyl)propoxy]-6-methoxyoxan-2-yl]methoxy]propylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 10676376 |
| Molecular Formula | C27H46O14S4 |
| Molecular Weight | 722.92 g/mol |
| Exact Mass | 722.18 |
| IUPAC Name | 2-[3-[[(2R,3R,4S,5R,6S)-3,4,5-tris[3-(carboxymethylsulfanyl)propoxy]-6-methoxyoxan-2-yl]methoxy]propylsulfanyl]acetic acid |
| SMILES | CO[C@H]1O[C@H](COCCCSCC(=O)O)[C@@H](OCCCSCC(=O)O)[C@H](OCCCSCC(=O)O)[C@H]1OCCCSCC(=O)O |
| InChI | InChI=1S/C27H46O14S4/c1-36-27-26(40-9-5-13-45-18-23(34)35)25(39-8-4-12-44-17-22(32)33)24(38-7-3-11-43-16-21(30)31)19(41-27)14-37-6-2-10-42-15-20(28)29/h19,24-27H,2-18H2,1H3,(H,28,29)(H,30,31)(H,32,33)(H,34,35)/t19-,24-,25+,26-,27+/m1/s1 |
| InChIKey | NSYYSOMQXGIQTK-IWNCDSNRSA-N |
| XLogP | 2.36 |
| TPSA | 204.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.92 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|