C36H68O10 — CID 71199347
dibutyl 2-[3-[3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]oxypropyl]propanedioate (PubChem CID 71199347) has the molecular formula C36H68O10 and a molecular weight of 660.93 g/mol. Its IUPAC name is dibutyl 2-[3-[3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]oxypropyl]propanedioate.
| Compound Name | dibutyl 2-[3-[3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]oxypropyl]propanedioate |
|---|---|
| PubChem CID | 71199347 |
| Molecular Formula | C36H68O10 |
| Molecular Weight | 660.93 g/mol |
| Exact Mass | 660.48 |
| IUPAC Name | dibutyl 2-[3-[3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]oxypropyl]propanedioate |
| SMILES | CCCCOCC1OC(OCCCC(C(=O)OCCCC)C(=O)OCCCC)C(OCCCC)C(OCCCC)C1OCCCC |
| InChI | InChI=1S/C36H68O10/c1-7-13-21-39-28-30-31(40-22-14-8-2)32(41-23-15-9-3)33(42-24-16-10-4)36(46-30)45-27-19-20-29(34(37)43-25-17-11-5)35(38)44-26-18-12-6/h29-33,36H,7-28H2,1-6H3 |
| InChIKey | XPIVWMBZYQUGTF-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.93 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|