C20H39NO6 — CID 54765523
N-[(3S,4R,5S,6R)-4,5-dibutoxy-6-(butoxymethyl)-2-hydroxyoxan-3-yl]acetamide (PubChem CID 54765523) has the molecular formula C20H39NO6 and a molecular weight of 389.53 g/mol. Its IUPAC name is N-[(3S,4R,5S,6R)-4,5-dibutoxy-6-(butoxymethyl)-2-hydroxyoxan-3-yl]acetamide.
| Compound Name | N-[(3S,4R,5S,6R)-4,5-dibutoxy-6-(butoxymethyl)-2-hydroxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 54765523 |
| Molecular Formula | C20H39NO6 |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | N-[(3S,4R,5S,6R)-4,5-dibutoxy-6-(butoxymethyl)-2-hydroxyoxan-3-yl]acetamide |
| SMILES | CCCCOC[C@H]1OC(O)[C@@H](NC(C)=O)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C20H39NO6/c1-5-8-11-24-14-16-18(25-12-9-6-2)19(26-13-10-7-3)17(20(23)27-16)21-15(4)22/h16-20,23H,5-14H2,1-4H3,(H,21,22)/t16-,17+,18-,19-,20?/m1/s1 |
| InChIKey | LWLKWHGJYJLZSY-XBYSNUDESA-N |
| XLogP | 2.40 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|