C45H77NO12 — CID 71159459
[2-[5-acetamido-4,6-dibutoxy-2-(butoxymethyl)oxan-3-yl]oxy-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl] benzoate (PubChem CID 71159459) has the molecular formula C45H77NO12 and a molecular weight of 824.11 g/mol. Its IUPAC name is [2-[5-acetamido-4,6-dibutoxy-2-(butoxymethyl)oxan-3-yl]oxy-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl] benzoate.
| Compound Name | [2-[5-acetamido-4,6-dibutoxy-2-(butoxymethyl)oxan-3-yl]oxy-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 71159459 |
| Molecular Formula | C45H77NO12 |
| Molecular Weight | 824.11 g/mol |
| Exact Mass | 823.54 |
| IUPAC Name | [2-[5-acetamido-4,6-dibutoxy-2-(butoxymethyl)oxan-3-yl]oxy-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl] benzoate |
| SMILES | CCCCOCC1OC(OCCCC)C(NC(C)=O)C(OCCCC)C1OC1OC(COCCCC)C(OCCCC)C(OCCCC)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C45H77NO12/c1-8-14-25-49-31-35-38(51-27-16-10-3)41(53-29-18-12-5)42(57-43(48)34-23-21-20-22-24-34)45(56-35)58-39-36(32-50-26-15-9-2)55-44(54-30-19-13-6)37(46-33(7)47)40(39)52-28-17-11-4/h20-24,35-42,44-45H,8-19,25-32H2,1-7H3,(H,46,47) |
| InChIKey | GYAVSMMNJDIMSC-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 138.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.11 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|