C51H50O16 — CID 89404794
[(3R,4S,6R)-4,5-dibenzoyloxy-6-butoxy-3-[(2S,4S,5S)-3,4-dibenzoyloxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl benzoate (PubChem CID 89404794) has the molecular formula C51H50O16 and a molecular weight of 918.95 g/mol. Its IUPAC name is [(3R,4S,6R)-4,5-dibenzoyloxy-6-butoxy-3-[(2S,4S,5S)-3,4-dibenzoyloxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(3R,4S,6R)-4,5-dibenzoyloxy-6-butoxy-3-[(2S,4S,5S)-3,4-dibenzoyloxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 89404794 |
| Molecular Formula | C51H50O16 |
| Molecular Weight | 918.95 g/mol |
| Exact Mass | 918.31 |
| IUPAC Name | [(3R,4S,6R)-4,5-dibenzoyloxy-6-butoxy-3-[(2S,4S,5S)-3,4-dibenzoyloxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl benzoate |
| SMILES | CCCCO[C@@H]1OC(COC(=O)c2ccccc2)[C@@H](O[C@@H]2OC(CO)[C@H](O)[C@H](OC(=O)c3ccccc3)C2OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C51H50O16/c1-2-3-29-59-50-44(66-49(58)36-27-17-8-18-28-36)42(64-47(56)34-23-13-6-14-24-34)40(38(62-50)31-60-45(54)32-19-9-4-10-20-32)67-51-43(65-48(57)35-25-15-7-16-26-35)41(39(53)37(30-52)61-51)63-46(55)33-21-11-5-12-22-33/h4-28,37-44,50-53H,2-3,29-31H2,1H3/t37?,38?,39-,40+,41-,42-,43?,44?,50+,51-/m0/s1 |
| InChIKey | SCDKHDNZTNZYIV-CVSZNUAMSA-N |
| XLogP | 5.75 |
| TPSA | 208.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.95 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|