C27H52O7 — CID 89321651
[(3R)-3-[2-[(2R,4R,5S)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]ethyl]oxiran-2-yl]methanol (PubChem CID 89321651) has the molecular formula C27H52O7 and a molecular weight of 488.71 g/mol. Its IUPAC name is [(3R)-3-[2-[(2R,4R,5S)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]ethyl]oxiran-2-yl]methanol.
| Compound Name | [(3R)-3-[2-[(2R,4R,5S)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]ethyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 89321651 |
| Molecular Formula | C27H52O7 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.37 |
| IUPAC Name | [(3R)-3-[2-[(2R,4R,5S)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]ethyl]oxiran-2-yl]methanol |
| SMILES | CCCCOCC1O[C@H](CC[C@H]2OC2CO)C(OCCCC)[C@@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C27H52O7/c1-5-9-15-29-20-24-26(31-17-11-7-3)27(32-18-12-8-4)25(30-16-10-6-2)22(34-24)14-13-21-23(19-28)33-21/h21-28H,5-20H2,1-4H3/t21-,22-,23?,24?,25?,26+,27-/m1/s1 |
| InChIKey | NMKCEROYLBKLNJ-ZTXXRTKUSA-N |
| XLogP | 4.67 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|