C27H52O5Si — CID 90251229
trimethyl-[2-[(2R,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]ethynyl]silane (PubChem CID 90251229) has the molecular formula C27H52O5Si and a molecular weight of 484.79 g/mol. Its IUPAC name is trimethyl-[2-[(2R,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[(2R,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]ethynyl]silane |
|---|---|
| PubChem CID | 90251229 |
| Molecular Formula | C27H52O5Si |
| Molecular Weight | 484.79 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | trimethyl-[2-[(2R,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]ethynyl]silane |
| SMILES | CCCCOC[C@H]1O[C@H](C#C[Si](C)(C)C)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C27H52O5Si/c1-8-12-17-28-22-24-26(30-19-14-10-3)27(31-20-15-11-4)25(29-18-13-9-2)23(32-24)16-21-33(5,6)7/h23-27H,8-15,17-20,22H2,1-7H3/t23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | CHHCGNSMVVNPRW-IURCNINISA-N |
| XLogP | 6.01 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.79 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|