C24H48O5S — CID 70658079
3,4,5-tributoxy-2-(butoxymethyl)-6-ethylsulfanyloxane (PubChem CID 70658079) has the molecular formula C24H48O5S and a molecular weight of 448.71 g/mol. Its IUPAC name is 3,4,5-tributoxy-2-(butoxymethyl)-6-ethylsulfanyloxane.
| Compound Name | 3,4,5-tributoxy-2-(butoxymethyl)-6-ethylsulfanyloxane |
|---|---|
| PubChem CID | 70658079 |
| Molecular Formula | C24H48O5S |
| Molecular Weight | 448.71 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 3,4,5-tributoxy-2-(butoxymethyl)-6-ethylsulfanyloxane |
| SMILES | CCCCOCC1OC(SCC)C(OCCCC)C(OCCCC)C1OCCCC |
| InChI | InChI=1S/C24H48O5S/c1-6-11-15-25-19-20-21(26-16-12-7-2)22(27-17-13-8-3)23(28-18-14-9-4)24(29-20)30-10-5/h20-24H,6-19H2,1-5H3 |
| InChIKey | ZXLBLTHGSMKFKD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.71 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|