C55H62O6S — CID 10653139
(2R,3R,4S,5S,6R)-2-ethylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(7-trityloxyheptoxymethyl)oxane (PubChem CID 10653139) has the molecular formula C55H62O6S and a molecular weight of 851.16 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-ethylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(7-trityloxyheptoxymethyl)oxane.
| Compound Name | (2R,3R,4S,5S,6R)-2-ethylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(7-trityloxyheptoxymethyl)oxane |
|---|---|
| PubChem CID | 10653139 |
| Molecular Formula | C55H62O6S |
| Molecular Weight | 851.16 g/mol |
| Exact Mass | 850.43 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-ethylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(7-trityloxyheptoxymethyl)oxane |
| SMILES | CCS[C@H]1O[C@H](COCCCCCCCOC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C55H62O6S/c1-2-62-54-53(59-42-46-30-16-8-17-31-46)52(58-41-45-28-14-7-15-29-45)51(57-40-44-26-12-6-13-27-44)50(61-54)43-56-38-24-4-3-5-25-39-60-55(47-32-18-9-19-33-47,48-34-20-10-21-35-48)49-36-22-11-23-37-49/h6-23,26-37,50-54H,2-5,24-25,38-43H2,1H3/t50-,51+,52+,53-,54-/m1/s1 |
| InChIKey | POPBUADMAMBMMW-GNWCQMMMSA-N |
| XLogP | 12.20 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.16 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|