C37H42O6S — CID 11146511
3-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylpropan-1-ol (PubChem CID 11146511) has the molecular formula C37H42O6S and a molecular weight of 614.80 g/mol. Its IUPAC name is 3-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylpropan-1-ol.
| Compound Name | 3-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 11146511 |
| Molecular Formula | C37H42O6S |
| Molecular Weight | 614.80 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | 3-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylpropan-1-ol |
| SMILES | OCCCS[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H42O6S/c38-22-13-23-44-37-36(42-27-32-20-11-4-12-21-32)35(41-26-31-18-9-3-10-19-31)34(40-25-30-16-7-2-8-17-30)33(43-37)28-39-24-29-14-5-1-6-15-29/h1-12,14-21,33-38H,13,22-28H2/t33-,34-,35+,36-,37+/m1/s1 |
| InChIKey | APSRIVIIKQCHIA-MANRWTMFSA-N |
| XLogP | 6.80 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.80 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|