C15H30O4 — CID 71048290
(2R,3S,4R,5S)-3-butoxy-2-(butoxymethyl)-5-methoxy-4-methyloxolane (PubChem CID 71048290) has the molecular formula C15H30O4 and a molecular weight of 274.40 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-butoxy-2-(butoxymethyl)-5-methoxy-4-methyloxolane.
| Compound Name | (2R,3S,4R,5S)-3-butoxy-2-(butoxymethyl)-5-methoxy-4-methyloxolane |
|---|---|
| PubChem CID | 71048290 |
| Molecular Formula | C15H30O4 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | (2R,3S,4R,5S)-3-butoxy-2-(butoxymethyl)-5-methoxy-4-methyloxolane |
| SMILES | CCCCOC[C@H]1O[C@H](OC)[C@H](C)[C@@H]1OCCCC |
| InChI | InChI=1S/C15H30O4/c1-5-7-9-17-11-13-14(18-10-8-6-2)12(3)15(16-4)19-13/h12-15H,5-11H2,1-4H3/t12-,13-,14+,15+/m1/s1 |
| InChIKey | OEBYWWLMKKBZAT-KBXIAJHMSA-N |
| XLogP | 3.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|