C18H36O6 — CID 70806740
(2S,5S)-3,4,5-tributoxy-6-(hydroxymethyl)oxan-2-ol (PubChem CID 70806740) has the molecular formula C18H36O6 and a molecular weight of 348.48 g/mol. Its IUPAC name is (2S,5S)-3,4,5-tributoxy-6-(hydroxymethyl)oxan-2-ol.
| Compound Name | (2S,5S)-3,4,5-tributoxy-6-(hydroxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 70806740 |
| Molecular Formula | C18H36O6 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (2S,5S)-3,4,5-tributoxy-6-(hydroxymethyl)oxan-2-ol |
| SMILES | CCCCOC1C(OCCCC)[C@@H](O)OC(CO)[C@@H]1OCCCC |
| InChI | InChI=1S/C18H36O6/c1-4-7-10-21-15-14(13-19)24-18(20)17(23-12-9-6-3)16(15)22-11-8-5-2/h14-20H,4-13H2,1-3H3/t14?,15-,16?,17?,18-/m0/s1 |
| InChIKey | WECMPHDUSLKRSX-FWIYHKBQSA-N |
| XLogP | 2.25 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|