C11H21IO4 — CID 89130516
(2S,3S,4R,6R)-4-butoxy-6-(hydroxymethyl)-5-iodo-2-methyloxan-3-ol (PubChem CID 89130516) has the molecular formula C11H21IO4 and a molecular weight of 344.19 g/mol. Its IUPAC name is (2S,3S,4R,6R)-4-butoxy-6-(hydroxymethyl)-5-iodo-2-methyloxan-3-ol.
| Compound Name | (2S,3S,4R,6R)-4-butoxy-6-(hydroxymethyl)-5-iodo-2-methyloxan-3-ol |
|---|---|
| PubChem CID | 89130516 |
| Molecular Formula | C11H21IO4 |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | (2S,3S,4R,6R)-4-butoxy-6-(hydroxymethyl)-5-iodo-2-methyloxan-3-ol |
| SMILES | CCCCO[C@H]1C(I)[C@@H](CO)O[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C11H21IO4/c1-3-4-5-15-11-9(12)8(6-13)16-7(2)10(11)14/h7-11,13-14H,3-6H2,1-2H3/t7-,8+,9?,10-,11-/m0/s1 |
| InChIKey | CTZAYIJITHZFPW-GDPLYGHDSA-N |
| XLogP | 1.12 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|