C15H29N3O4 — CID 167593048
[(3S,4R,6S)-5-azido-3,4-dibutoxy-6-methyloxan-2-yl]methanol (PubChem CID 167593048) has the molecular formula C15H29N3O4 and a molecular weight of 315.41 g/mol. Its IUPAC name is [(3S,4R,6S)-5-azido-3,4-dibutoxy-6-methyloxan-2-yl]methanol.
| Compound Name | [(3S,4R,6S)-5-azido-3,4-dibutoxy-6-methyloxan-2-yl]methanol |
|---|---|
| PubChem CID | 167593048 |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | [(3S,4R,6S)-5-azido-3,4-dibutoxy-6-methyloxan-2-yl]methanol |
| SMILES | CCCCO[C@@H]1C(CO)O[C@@H](C)C(N=[N+]=[N-])[C@H]1OCCCC |
| InChI | InChI=1S/C15H29N3O4/c1-4-6-8-20-14-12(10-19)22-11(3)13(17-18-16)15(14)21-9-7-5-2/h11-15,19H,4-10H2,1-3H3/t11-,12?,13?,14+,15+/m0/s1 |
| InChIKey | YRILJLBMPOEELA-HTXSYXIBSA-N |
| XLogP | 2.82 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|