C24H47N3O6 — CID 126541904
[6-(6-azidohexoxy)-3,4,5-tributoxyoxan-2-yl]methanol (PubChem CID 126541904) has the molecular formula C24H47N3O6 and a molecular weight of 473.66 g/mol. Its IUPAC name is [6-(6-azidohexoxy)-3,4,5-tributoxyoxan-2-yl]methanol.
| Compound Name | [6-(6-azidohexoxy)-3,4,5-tributoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 126541904 |
| Molecular Formula | C24H47N3O6 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.35 |
| IUPAC Name | [6-(6-azidohexoxy)-3,4,5-tributoxyoxan-2-yl]methanol |
| SMILES | CCCCOC1C(CO)OC(OCCCCCCN=[N+]=[N-])C(OCCCC)C1OCCCC |
| InChI | InChI=1S/C24H47N3O6/c1-4-7-15-29-21-20(19-28)33-24(32-18-13-11-10-12-14-26-27-25)23(31-17-9-6-3)22(21)30-16-8-5-2/h20-24,28H,4-19H2,1-3H3 |
| InChIKey | QIQGCOCLNJWIIS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|