C20H39N3O10 — CID 132555534
3-[[(2R,3R,4S,5R,6R)-6-(2-azidoethoxy)-3,4,5-tris(3-hydroxypropoxy)oxan-2-yl]methoxy]propan-1-ol (PubChem CID 132555534) has the molecular formula C20H39N3O10 and a molecular weight of 481.54 g/mol. Its IUPAC name is 3-[[(2R,3R,4S,5R,6R)-6-(2-azidoethoxy)-3,4,5-tris(3-hydroxypropoxy)oxan-2-yl]methoxy]propan-1-ol.
| Compound Name | 3-[[(2R,3R,4S,5R,6R)-6-(2-azidoethoxy)-3,4,5-tris(3-hydroxypropoxy)oxan-2-yl]methoxy]propan-1-ol |
|---|---|
| PubChem CID | 132555534 |
| Molecular Formula | C20H39N3O10 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 3-[[(2R,3R,4S,5R,6R)-6-(2-azidoethoxy)-3,4,5-tris(3-hydroxypropoxy)oxan-2-yl]methoxy]propan-1-ol |
| SMILES | [N-]=[N+]=NCCO[C@@H]1O[C@H](COCCCO)[C@@H](OCCCO)[C@H](OCCCO)[C@H]1OCCCO |
| InChI | InChI=1S/C20H39N3O10/c21-23-22-5-14-32-20-19(31-13-4-9-27)18(30-12-3-8-26)17(29-11-2-7-25)16(33-20)15-28-10-1-6-24/h16-20,24-27H,1-15H2/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | YMTRILLPDGPSDN-OUUBHVDSSA-N |
| XLogP | -0.26 |
| TPSA | 185.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|