C20H31N3O6 — CID 132604145
(2R,3R,4S,5R,6R)-2-(2-azidoethoxy)-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane (PubChem CID 132604145) has the molecular formula C20H31N3O6 and a molecular weight of 409.48 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(2-azidoethoxy)-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane.
| Compound Name | (2R,3R,4S,5R,6R)-2-(2-azidoethoxy)-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
|---|---|
| PubChem CID | 132604145 |
| Molecular Formula | C20H31N3O6 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(2-azidoethoxy)-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
| SMILES | C=CCOC[C@H]1O[C@@H](OCCN=[N+]=[N-])[C@H](OCC=C)[C@@H](OCC=C)[C@@H]1OCC=C |
| InChI | InChI=1S/C20H31N3O6/c1-5-10-24-15-16-17(25-11-6-2)18(26-12-7-3)19(27-13-8-4)20(29-16)28-14-9-22-23-21/h5-8,16-20H,1-4,9-15H2/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | WFPZUZUELOZLHU-OUUBHVDSSA-N |
| XLogP | 2.95 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|