C18H27BrO5 — CID 167455087
(2R,3R,4S,5R,6R)-2-bromo-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane (PubChem CID 167455087) has the molecular formula C18H27BrO5 and a molecular weight of 403.31 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-bromo-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane.
| Compound Name | (2R,3R,4S,5R,6R)-2-bromo-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
|---|---|
| PubChem CID | 167455087 |
| Molecular Formula | C18H27BrO5 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-bromo-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
| SMILES | C=CCOC[C@H]1O[C@H](Br)[C@H](OCC=C)[C@@H](OCC=C)[C@@H]1OCC=C |
| InChI | InChI=1S/C18H27BrO5/c1-5-9-20-13-14-15(21-10-6-2)16(22-11-7-3)17(18(19)24-14)23-12-8-4/h5-8,14-18H,1-4,9-13H2/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | PTAFZDXNVJKAGB-SFFUCWETSA-N |
| XLogP | 3.02 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|