C15H23FO4 — CID 163409542
(2R,3S,4R,6R)-6-fluoro-3,4-bis(prop-2-enoxy)-2-(prop-2-enoxymethyl)oxane (PubChem CID 163409542) has the molecular formula C15H23FO4 and a molecular weight of 286.34 g/mol. Its IUPAC name is (2R,3S,4R,6R)-6-fluoro-3,4-bis(prop-2-enoxy)-2-(prop-2-enoxymethyl)oxane.
| Compound Name | (2R,3S,4R,6R)-6-fluoro-3,4-bis(prop-2-enoxy)-2-(prop-2-enoxymethyl)oxane |
|---|---|
| PubChem CID | 163409542 |
| Molecular Formula | C15H23FO4 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (2R,3S,4R,6R)-6-fluoro-3,4-bis(prop-2-enoxy)-2-(prop-2-enoxymethyl)oxane |
| SMILES | C=CCOC[C@H]1O[C@H](F)C[C@@H](OCC=C)[C@@H]1OCC=C |
| InChI | InChI=1S/C15H23FO4/c1-4-7-17-11-13-15(19-9-6-3)12(18-8-5-2)10-14(16)20-13/h4-6,12-15H,1-3,7-11H2/t12-,13-,14+,15+/m1/s1 |
| InChIKey | RCZQKYXGAGNVHE-KBXIAJHMSA-N |
| XLogP | 2.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|