C24H39N3O8 — CID 163856368
(2R,3R,4S,5R,6S)-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-5-(ethenoxymethyl)-3,4-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane (PubChem CID 163856368) has the molecular formula C24H39N3O8 and a molecular weight of 497.59 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-5-(ethenoxymethyl)-3,4-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane.
| Compound Name | (2R,3R,4S,5R,6S)-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-5-(ethenoxymethyl)-3,4-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
|---|---|
| PubChem CID | 163856368 |
| Molecular Formula | C24H39N3O8 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-5-(ethenoxymethyl)-3,4-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
| SMILES | C=CCOC[C@H]1O[C@@H](OCCOCCOCCN=[N+]=[N-])[C@H](OCC=C)[C@@H](OCC=C)[C@@H]1COC=C |
| InChI | InChI=1S/C24H39N3O8/c1-5-10-31-19-21-20(18-28-8-4)22(32-11-6-2)23(33-12-7-3)24(35-21)34-17-16-30-15-14-29-13-9-26-27-25/h5-8,20-24H,1-4,9-19H2/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | UBOLJJILVCFYKZ-GNADVCDUSA-N |
| XLogP | 3.19 |
| TPSA | 122.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|