C41H46N4O6 — CID 54059930
3-[2-[(2R,3R,4S,5R,6R)-6-(4-azidobutoxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyethyl]-1H-indole (PubChem CID 54059930) has the molecular formula C41H46N4O6 and a molecular weight of 690.84 g/mol. Its IUPAC name is 3-[2-[(2R,3R,4S,5R,6R)-6-(4-azidobutoxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyethyl]-1H-indole.
| Compound Name | 3-[2-[(2R,3R,4S,5R,6R)-6-(4-azidobutoxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyethyl]-1H-indole |
|---|---|
| PubChem CID | 54059930 |
| Molecular Formula | C41H46N4O6 |
| Molecular Weight | 690.84 g/mol |
| Exact Mass | 690.34 |
| IUPAC Name | 3-[2-[(2R,3R,4S,5R,6R)-6-(4-azidobutoxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyethyl]-1H-indole |
| SMILES | [N-]=[N+]=NCCCCOC[C@H]1O[C@@H](OCCc2c[nH]c3ccccc23)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H46N4O6/c42-45-44-23-12-13-24-46-30-37-38(48-27-31-14-4-1-5-15-31)39(49-28-32-16-6-2-7-17-32)40(50-29-33-18-8-3-9-19-33)41(51-37)47-25-22-34-26-43-36-21-11-10-20-35(34)36/h1-11,14-21,26,37-41,43H,12-13,22-25,27-30H2/t37-,38-,39+,40-,41-/m1/s1 |
| InChIKey | LYYKBZAJICOSKR-PGSFLWIGSA-N |
| XLogP | 8.32 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.84 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|