C48H52N4O7S — CID 10819261
3-[2-[(2R,3R,4S,5S,6S)-6-(5-azidopentoxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethyl]-1-(benzenesulfonyl)indole (PubChem CID 10819261) has the molecular formula C48H52N4O7S and a molecular weight of 829.03 g/mol. Its IUPAC name is 3-[2-[(2R,3R,4S,5S,6S)-6-(5-azidopentoxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethyl]-1-(benzenesulfonyl)indole.
| Compound Name | 3-[2-[(2R,3R,4S,5S,6S)-6-(5-azidopentoxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethyl]-1-(benzenesulfonyl)indole |
|---|---|
| PubChem CID | 10819261 |
| Molecular Formula | C48H52N4O7S |
| Molecular Weight | 829.03 g/mol |
| Exact Mass | 828.36 |
| IUPAC Name | 3-[2-[(2R,3R,4S,5S,6S)-6-(5-azidopentoxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethyl]-1-(benzenesulfonyl)indole |
| SMILES | [N-]=[N+]=NCCCCCOC[C@@H]1O[C@H](CCc2cn(S(=O)(=O)c3ccccc3)c3ccccc23)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C48H52N4O7S/c49-51-50-30-16-5-17-31-55-36-45-47(57-34-38-20-8-2-9-21-38)48(58-35-39-22-10-3-11-23-39)46(56-33-37-18-6-1-7-19-37)44(59-45)29-28-40-32-52(43-27-15-14-26-42(40)43)60(53,54)41-24-12-4-13-25-41/h1-4,6-15,18-27,32,44-48H,5,16-17,28-31,33-36H2/t44-,45+,46-,47+,48+/m1/s1 |
| InChIKey | XUHUDSLJGHSJDA-GPEXLQPFSA-N |
| XLogP | 9.83 |
| TPSA | 133.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.03 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|