C49H50N2O9S — CID 70224009
2-[5-[[(2S,4S,5R,6S)-6-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-4,5-bis(phenylmethoxy)oxan-2-yl]methoxy]pentyl]isoindole-1,3-dione (PubChem CID 70224009) has the molecular formula C49H50N2O9S and a molecular weight of 843.01 g/mol. Its IUPAC name is 2-[5-[[(2S,4S,5R,6S)-6-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-4,5-bis(phenylmethoxy)oxan-2-yl]methoxy]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[5-[[(2S,4S,5R,6S)-6-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-4,5-bis(phenylmethoxy)oxan-2-yl]methoxy]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70224009 |
| Molecular Formula | C49H50N2O9S |
| Molecular Weight | 843.01 g/mol |
| Exact Mass | 842.32 |
| IUPAC Name | 2-[5-[[(2S,4S,5R,6S)-6-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-4,5-bis(phenylmethoxy)oxan-2-yl]methoxy]pentyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCOC[C@@H]1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](OCCc2cn(S(=O)(=O)c3ccccc3)c3ccccc23)O1 |
| InChI | InChI=1S/C49H50N2O9S/c52-47-42-24-11-12-25-43(42)48(53)50(47)28-15-4-16-29-56-35-39-31-45(58-33-36-17-5-1-6-18-36)46(59-34-37-19-7-2-8-20-37)49(60-39)57-30-27-38-32-51(44-26-14-13-23-41(38)44)61(54,55)40-21-9-3-10-22-40/h1-3,5-14,17-26,32,39,45-46,49H,4,15-16,27-31,33-35H2/t39-,45-,46+,49-/m0/s1 |
| InChIKey | LWSFOCYEERGAAE-QWHAZYITSA-N |
| XLogP | 8.21 |
| TPSA | 122.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.01 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|