C28H31NO10S — CID 67746700
[(2R,3R,5R,6R)-3,5-diacetyloxy-6-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 67746700) has the molecular formula C28H31NO10S and a molecular weight of 573.62 g/mol. Its IUPAC name is [(2R,3R,5R,6R)-3,5-diacetyloxy-6-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,5R,6R)-3,5-diacetyloxy-6-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67746700 |
| Molecular Formula | C28H31NO10S |
| Molecular Weight | 573.62 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | [(2R,3R,5R,6R)-3,5-diacetyloxy-6-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCCc2cn(S(=O)(=O)c3ccccc3)c3ccccc23)[C@H](OC(C)=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H31NO10S/c1-18(30)36-17-27-25(37-19(2)31)15-26(38-20(3)32)28(39-27)35-14-13-21-16-29(24-12-8-7-11-23(21)24)40(33,34)22-9-5-4-6-10-22/h4-12,16,25-28H,13-15,17H2,1-3H3/t25-,26-,27-,28-/m1/s1 |
| InChIKey | RXKLIXXNUHRHME-BIYDSLDMSA-N |
| XLogP | 2.98 |
| TPSA | 136.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.62 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|